Description Usage Arguments Details Value Author(s) Examples
View source: R/482-extractDrugOBFP4.R
Calculate the FP4 Molecular Fingerprints
1 | extrDrugOBFP4(molecules, type = c("smile", "sdf"))
|
molecules |
R character string object containing the molecules. See the example section for details. |
type |
|
Calculate the 512 bit FP4 fingerprints provided by OpenBabel.
A matrix. Each row represents one molecule, the columns represent the fingerprints.
Min-feng Zhu <wind2zhu@163.com>, Nan Xiao <http://r2s.name>
1 2 3 4 5 6 | mol1 = 'C1CCC1CC(CN(C)(C))CC(=O)CC' # one molecule SMILE in a vector
mol2 = c('CCC', 'CCN', 'CCN(C)(C)', 'c1ccccc1Cc1ccccc1',
'C1CCC1CC(CN(C)(C))CC(=O)CC') # multiple SMILEs in a vector
smifp0 = extrDrugOBFP4(mol1, type = 'smile')
smifp1 = extrDrugOBFP4(mol2, type = 'smile')
|
Add the following code to your website.
For more information on customizing the embed code, read Embedding Snippets.