viewstr: view 2D structures from SMILES string vector
In iqspr: Inverse Molecular Design

View 2D structures from SMILES strings vector

1 2	viewstr(smis = NULL, width = 500, height = 500, nrow = 2, ncol = 2, legend = "")

`smis`	is a SMILES strings vector to submit.
`width`	of the picture
`height`	of the picture
`nrow`	is the number of rows for the table of molecular depictions
`ncol`	is the number of columns for the table of molecular depictions
`legend`	is the text to appear for each molecular depiction in the top left corner

a plot of requested 2D structures.

1 2	viewstr(c("c1ccc2ccc3c(NCCN(C)C)cc(nc3c2c1)", "c1ccc2ccc3c(NCCN(CC)CCCl)cc(nc3c2c1)", "c1ccc2ccc3c(NC(CC)CC)cc(nc3c2c1)", "c1ccc2ccc3c(c2c1)ncc(c3NCCNCC=CCCCC)"))