| extractDrugOBFP2 | R Documentation |
Calculate the FP2 Molecular Fingerprints
extractDrugOBFP2(molecules, type = c("smile", "sdf"))
molecules |
R character string object containing the molecules. See the example section for details. |
type |
|
Calculate the 1024 bit FP2 fingerprints provided by OpenBabel.
A matrix. Each row represents one molecule, the columns represent the fingerprints.
mol1 = 'C1CCC1CC(CN(C)(C))CC(=O)CC' # one molecule SMILE in a vector
mol2 = c('CCC', 'CCN', 'CCN(C)(C)', 'c1ccccc1Cc1ccccc1',
'C1CCC1CC(CN(C)(C))CC(=O)CC') # multiple SMILEs in a vector
mol3 = readChar(system.file('compseq/DB00860.sdf', package = 'Rcpi'),
nchars = 1e+6) # single molecule in a sdf file
mol4 = readChar(system.file('sysdata/OptAA3d.sdf', package = 'Rcpi'),
nchars = 1e+6) # multiple molecules in a sdf file
## Not run:
smifp0 = extractDrugOBFP2(mol1, type = 'smile')
smifp1 = extractDrugOBFP2(mol2, type = 'smile')
sdffp0 = extractDrugOBFP2(mol3, type = 'sdf')
sdffp1 = extractDrugOBFP2(mol4, type = 'sdf')
## End(Not run)
Add the following code to your website.
For more information on customizing the embed code, read Embedding Snippets.