#' @name x_annotation
#'
#' @title Example annotation for \code{MetNet}: data input
#'
#' @description \code{x_annotation} contains one selected putative annotation of
#' \code{x_test}. Missing annotations are filled with `NA`'s. It will be used as an example annotation in the vignette to
#' show the functionality of the packages.
#'
#' @docType data
#'
#' @return \code{matrix}
#'
#' @format \code{matrix}
#'
#' @source
#' data("x_test", package = "MetNet")
#'
#' x_annotation <- x_test[,1:2]
#'
#' x_annotation <- cbind(x_annotation,"database_mz" = NA,
#' "database_identifier" = NA,
#' "chemical_formula" = NA,
#' "smiles" = NA,
#' "inchi" = NA,
#' "inchikey" = NA,
#' "metabolite_identification" = NA,
#' "fragmentations" = NA,
#' "modifications" = NA,
#' "charge" = NA,
#' "database" = NA)
#'
#'x1856 <- cbind(x_annotation["x1856", "mz"],
#' x_annotation["x1856", "rt"],
#' "database_mz" = 308.2,
#' "database_identifier" = "N-caffeoylspermidine",
#' "chemical_formula" = "C16H25N3O3",
#' "smiles" = "C=1(C=C(C(=CC1)O)O)/C=C/C(NCCCNCCCCN)=O",
#' "inchi" = "InChI=1S/C16H25N3O3/c17-8-1-2-9-18-10-3-11-19-16(22)7-5-13-4-6-14(20)15(21)12-13/h4-7,12,18,20-21H,1-3,8-11,17H2,(H,19,22)/b7-5+",
#' "inchikey" = "AZSUJBAOTYNFDE-FNORWQNLSA-N",
#' "metabolite_identification" = NA,
#' "fragmentations" = NA,
#' "modifications" = NA,
#' "charge" = 1,
#' "database" = NA)
#'
#'x_annotation[rownames(x_annotation) == "x1856",] <- x1856
#'x_annotation <- x_annotation[,-c(1:2)]
#'
#' @author Liesa Salzer, \email{liesa.salzer@@helmholtz-muenchen.de}
NULL
Add the following code to your website.
For more information on customizing the embed code, read Embedding Snippets.