Nothing
# Model selection:
ggmModSelect <- function(
S, # Sample covariance matrix
n, # Sample size
gamma = 0, # EBIC parameter, set to 0 for BIC selection
start = c("glasso","empty","full"),
stepwise = TRUE,
considerPerStep = c("subset","all"), # Subset will only consider changing edges that previously would improve EBIC. When no edge improves. All edges are tested again.
verbose = TRUE,
nCores = 1,
checkPD = TRUE,
criterion = "ebic",
... # EBICglasso arguments for starting point
) {
if (is.character(start)){
# Start:
start <- match.arg(start)
} else {
startMat <- start
start <- "manual"
}
# Number of variables:
nVar <- ncol(S)
# Warning if there are many variables:
if (nVar > 30 && stepwise && verbose){
message("'ggmModSelect' using stepwise = TRUE may be very slow in large graphs (> 30 nodes). Consider setting stepwise = FALSE")
}
if (checkPD){
if (any(eigen(S)$values < 0)) stop("'S' is not positive definite")
}
# Standardize cov matrix:
S <- cov2cor(S)
### Starting graph ###
if (start == "glasso"){
if (verbose) message("Running glasso to obtain starting model...")
# Run the glassopath:
glassores <- EBICglassoCore(
S = S, # Sample covariance matrix
n = n, # Sample size
gamma = gamma,
refit = TRUE, # If TRUE, network structure is taken and non-penalized version is computed.
ebicMethod = "new",
regularized = FALSE,
threshold = FALSE,
verbose = FALSE,
returnAllResults = TRUE,
criterion = criterion)
curGraph <- glassores$optnet
curEBIC <- min(glassores$ebic)
} else if (start == "empty"){
curGraph <- matrix(0, nVar, nVar)
fit <- ggmFit(curGraph, S, n, verbose = FALSE, ebicTuning = gamma)
curEBIC <- fit$fitMeasures[[criterion]]
} else if (start == "full"){
curGraph <- corpcor::cor2pcor(cov2cor(S))
fit <- ggmFit(curGraph, S, n, verbose = FALSE, ebicTuning = gamma)
curEBIC <- fit$fitMeasures[[criterion]]
} else if (start == "manual"){
curGraph <- startMat
fit <- ggmFit(startMat, S, n, verbose = FALSE, ebicTuning = gamma, refit = TRUE)
curEBIC <- fit$fitMeasures[[criterion]]
}
# If not stepwise model search, stop here:
if (!stepwise){
Results <- list(
graph = curGraph,
criterion = curEBIC
)
return(Results)
}
# Parallel:
if (nCores > 1){
cl <- parallel::makePSOCKcluster(nCores - 1)
# Export to cluster:
parallel::clusterExport(cl, c("S","n"), envir = environment())
} else {
cl <- NULL
}
# Edges to currently consider:
curSkel <- curGraph!=0
curEdges <- curSkel[upper.tri(curSkel)]
curConsider <- rep(TRUE,length(curEdges))
# Now perform stepwise model selection until optimum is reached:
repeat{
# Form all graphs to consider:
allGraphs <- lapply(which(curConsider),function(i){
testEdges <- curEdges
testEdges[i] <- !curEdges[i]
testSkel <- matrix(0,nVar,nVar)
testSkel[upper.tri(testSkel)] <- 1*testEdges
testSkel[lower.tri(testSkel)] <- t(testSkel)[lower.tri(testSkel)]
testSkel
})
# Run the loop:
if (all(curConsider)){
if (verbose) message("Testing all edges...")
} else {
if (verbose) message("Testing subset of edges...")
}
Results <- pblapply(allGraphs,function(G){
# Fit graph:
if (!all(G[upper.tri(G)] != 0)){
suppressWarnings(glassores_test <- glasso::glasso(S, 0, zero = which(G == 0 & upper.tri(G), arr.ind=TRUE), trace = 0, penalize.diagonal=FALSE, ...))
} else {
suppressWarnings(glassores_test <- glasso::glasso(S, 0, trace = 0, penalize.diagonal=FALSE, ...))
}
# Compute EBIC:
fit <- ggmFit(invSigma = glassores_test$wi,covMat = S, sampleSize = n, ebicTuning = gamma, refit = FALSE)
return(list(
graph = wi2net(glassores_test$wi),
criterion = fit$fitMeasures[[criterion]]
))
}, cl = cl)
# All EBICs:
EBICs <- sapply(Results,"[[","criterion")
# Test if any smaller:
if (any(EBICs < curEBIC)){
# Update which to consider:
curConsider[curConsider] <- EBICs < curEBIC
# Find optimal network:
optnet <- which.min(EBICs)
curGraph <- Results[[optnet]]$graph
curEBIC <- Results[[optnet]]$criterion
curConsider[optnet] <- FALSE
if (verbose) message("Changed one edge...")
# Update current edges:
if (!any(curConsider)){
curConsider[] <- TRUE
}
curSkel <- curGraph!=0
curEdges <- curSkel[upper.tri(curSkel)]
} else {
# If we were considering all edges, break:
if (all(curConsider)){
break
} else {
# Else consider all edges again:
curConsider[] <- TRUE
}
}
}
# stop cluster:
if (nCores > 1){
parallel::stopCluster(cl)
}
if (!is.null(colnames(S))){
rownames(curGraph) <- colnames(curGraph) <- colnames(S)
}
return(list(
graph = as.matrix(curGraph),
criterion = curEBIC
))
}
Any scripts or data that you put into this service are public.
Add the following code to your website.
For more information on customizing the embed code, read Embedding Snippets.