extractDrugOBFP4: Calculate the FP4 Molecular Fingerprints

Description Usage Arguments Details Value Author(s) Examples


Calculate the FP4 Molecular Fingerprints


extractDrugOBFP4(molecules, type = c("smile", "sdf"))



R character string object containing the molecules. See the example section for details.


'smile' or 'sdf'.


Calculate the 512 bit FP4 fingerprints provided by OpenBabel.


A matrix. Each row represents one molecule, the columns represent the fingerprints.


Nan Xiao <http://nanx.me>


mol1 = 'C1CCC1CC(CN(C)(C))CC(=O)CC'  # one molecule SMILE in a vector
mol2 = c('CCC', 'CCN', 'CCN(C)(C)', 'c1ccccc1Cc1ccccc1',
         'C1CCC1CC(CN(C)(C))CC(=O)CC')  # multiple SMILEs in a vector
mol3 = readChar(system.file('compseq/DB00860.sdf', package = 'Rcpi'),
                nchars = 1e+6)  # single molecule in a sdf file
mol4 = readChar(system.file('sysdata/OptAA3d.sdf', package = 'Rcpi'),
                nchars = 1e+6)  # multiple molecules in a sdf file

smifp0 = extractDrugOBFP4(mol1, type = 'smile')
smifp1 = extractDrugOBFP4(mol2, type = 'smile')
sdffp0 = extractDrugOBFP4(mol3, type = 'sdf')
sdffp1 = extractDrugOBFP4(mol4, type = 'sdf')

Questions? Problems? Suggestions? or email at ian@mutexlabs.com.

Please suggest features or report bugs with the GitHub issue tracker.

All documentation is copyright its authors; we didn't write any of that.