R/381-extractDrugOBFP3.R

#' Calculate the FP3 Molecular Fingerprints
#'
#' Calculate the FP3 Molecular Fingerprints
#'
#' Calculate the 64 bit FP3 fingerprints provided by OpenBabel.
#'
#' @param molecules R character string object containing the molecules.
#' See the example section for details.
#' @param type \code{'smile'} or \code{'sdf'}.
#'
#' @return A matrix. Each row represents one molecule,
#' the columns represent the fingerprints.
#'
#' @keywords extractDrugOBFP3
#'
#' @aliases extractDrugOBFP3
#'
#' @author Nan Xiao <\url{https://nanx.me}>
#'
#' @export extractDrugOBFP3
#'
#' @examples
#' mol1 = 'C1CCC1CC(CN(C)(C))CC(=O)CC'  # one molecule SMILE in a vector
#' mol2 = c('CCC', 'CCN', 'CCN(C)(C)', 'c1ccccc1Cc1ccccc1',
#'          'C1CCC1CC(CN(C)(C))CC(=O)CC')  # multiple SMILEs in a vector
#' mol3 = readChar(system.file('compseq/DB00860.sdf', package = 'Rcpi'),
#'                 nchars = 1e+6)  # single molecule in a sdf file
#' mol4 = readChar(system.file('sysdata/OptAA3d.sdf', package = 'Rcpi'),
#'                 nchars = 1e+6)  # multiple molecules in a sdf file
#' \donttest{
#' smifp0 = extractDrugOBFP3(mol1, type = 'smile')
#' smifp1 = extractDrugOBFP3(mol2, type = 'smile')
#' sdffp0 = extractDrugOBFP3(mol3, type = 'sdf')
#' sdffp1 = extractDrugOBFP3(mol4, type = 'sdf')}

extractDrugOBFP3 = function (molecules, type = c('smile', 'sdf')) {

    if (type == 'smile') {

        if ( length(molecules) == 1L ) {

            molRefs = ChemmineOB::forEachMol('SMILES', molecules, identity)
            fp = ChemmineOB::fingerprint_OB(molRefs, 'FP3')

        } else if ( length(molecules) > 1L ) {

            fp = matrix(0L, nrow = length(molecules), ncol = 64L)

            for ( i in 1:length(molecules) ) {
                molRefs = ChemmineOB::forEachMol('SMILES', molecules[i], identity)
                fp[i, ] = ChemmineOB::fingerprint_OB(molRefs, 'FP3')
            }

        }

    } else if (type == 'sdf') {

        smi = ChemmineOB::convertFormat(from = 'SDF', to = 'SMILES',
                                        source = molecules)
        smiclean = strsplit(smi, '\\t.*?\\n')[[1]]

        if ( length(smiclean) == 1L ) {

            molRefs = ChemmineOB::forEachMol('SMILES', smiclean, identity)
            fp = ChemmineOB::fingerprint_OB(molRefs, 'FP3')

        } else if ( length(smiclean) > 1L ) {

            fp = matrix(0L, nrow = length(smiclean), ncol = 64L)
            for ( i in 1:length(smiclean) ) {
                molRefs = ChemmineOB::forEachMol('SMILES', smiclean[i], identity)
                fp[i, ] = ChemmineOB::fingerprint_OB(molRefs, 'FP3')
            }

        }

    } else {

        stop('Molecule type must be "smile" or "sdf"')

    }

    return(fp)

}

Try the Rcpi package in your browser

Any scripts or data that you put into this service are public.

Rcpi documentation built on Nov. 8, 2020, 8:23 p.m.