Nothing
#' Calculate the FP4 Molecular Fingerprints
#'
#' Calculate the FP4 Molecular Fingerprints
#'
#' Calculate the 512 bit FP4 fingerprints provided by OpenBabel.
#'
#' @param molecules R character string object containing the molecules.
#' See the example section for details.
#' @param type \code{'smile'} or \code{'sdf'}.
#'
#' @return A matrix. Each row represents one molecule,
#' the columns represent the fingerprints.
#'
#' @keywords extractDrugOBFP4
#'
#' @aliases extractDrugOBFP4
#'
#' @author Nan Xiao <\url{https://nanx.me}>
#'
#' @export extractDrugOBFP4
#'
#' @examples
#' mol1 = 'C1CCC1CC(CN(C)(C))CC(=O)CC' # one molecule SMILE in a vector
#' mol2 = c('CCC', 'CCN', 'CCN(C)(C)', 'c1ccccc1Cc1ccccc1',
#' 'C1CCC1CC(CN(C)(C))CC(=O)CC') # multiple SMILEs in a vector
#' mol3 = readChar(system.file('compseq/DB00860.sdf', package = 'Rcpi'),
#' nchars = 1e+6) # single molecule in a sdf file
#' mol4 = readChar(system.file('sysdata/OptAA3d.sdf', package = 'Rcpi'),
#' nchars = 1e+6) # multiple molecules in a sdf file
#'
#' \donttest{
#' smifp0 = extractDrugOBFP4(mol1, type = 'smile')
#' smifp1 = extractDrugOBFP4(mol2, type = 'smile')
#' sdffp0 = extractDrugOBFP4(mol3, type = 'sdf')
#' sdffp1 = extractDrugOBFP4(mol4, type = 'sdf')}
extractDrugOBFP4 = function (molecules, type = c('smile', 'sdf')) {
if (type == 'smile') {
if ( length(molecules) == 1L ) {
molRefs = ChemmineOB::forEachMol('SMILES', molecules, identity)
fp = ChemmineOB::fingerprint_OB(molRefs, 'FP4')
} else if ( length(molecules) > 1L ) {
fp = matrix(0L, nrow = length(molecules), ncol = 512L)
for ( i in 1:length(molecules) ) {
molRefs = ChemmineOB::forEachMol('SMILES', molecules[i], identity)
fp[i, ] = ChemmineOB::fingerprint_OB(molRefs, 'FP4')
}
}
} else if (type == 'sdf') {
smi = ChemmineOB::convertFormat(from = 'SDF', to = 'SMILES',
source = molecules)
smiclean = strsplit(smi, '\\t.*?\\n')[[1]]
if ( length(smiclean) == 1L ) {
molRefs = ChemmineOB::forEachMol('SMILES', smiclean, identity)
fp = ChemmineOB::fingerprint_OB(molRefs, 'FP4')
} else if ( length(smiclean) > 1L ) {
fp = matrix(0L, nrow = length(smiclean), ncol = 512L)
for ( i in 1:length(smiclean) ) {
molRefs = ChemmineOB::forEachMol('SMILES', smiclean[i], identity)
fp[i, ] = ChemmineOB::fingerprint_OB(molRefs, 'FP4')
}
}
} else {
stop('Molecule type must be "smile" or "sdf"')
}
return(fp)
}
Any scripts or data that you put into this service are public.
Add the following code to your website.
For more information on customizing the embed code, read Embedding Snippets.