#' @title Weights of all isotopes of all elements used
#' @description Sourced from 'enviPat' package
"isotopes"
#' @title Remove structures where isotope generation failed.
#' @description Sometimes if a run crashes, or a structure is bugged somehow, it is still registered as 'done' in the extended database and cannot be redone. This function removes these structures. Warning: slow!
#' @param outfolder Which folder are your databases in?
#' @param ext.dbname Extended database name (without .db suffix), Default: 'extended'
#' @seealso
#' \code{\link[RSQLite]{SQLite}}
#' @rdname removeFailedStructures
#' @export
#' @importFrom RSQLite dbConnect SQLite dbExecute dbDisconnect
removeFailedStructures <- function(outfolder,
ext.dbname = "extended"){
outfolder <- normalizePath(outfolder)
print(paste("Will remove failed isotope calculations, this may take a while. Removing structures from structure list that didn't make it into isotope calculation."))
full.db <- file.path(outfolder, paste0(ext.dbname, ".db"))
first.db <- !file.exists(full.db)
if(first.db){
print("Can't do this on a new db! :-(")
return(NULL)
}else{
full.conn <- RSQLite::dbConnect(RSQLite::SQLite(), full.db)
RSQLite::dbExecute(full.conn,
"CREATE INDEX IF NOT EXISTS ext_id ON extended(struct_id)")
RSQLite::dbExecute(full.conn,
"DELETE FROM structures
WHERE struct_id IN(SELECT structures.struct_id
FROM structures
LEFT JOIN extended
ON structures.struct_id=extended.struct_id
WHERE extended.struct_id IS NULL)"
)
RSQLite::dbDisconnect(full.conn)
}
}
#' @title Check which structures are OK according to given adduct rules
#' @description Calculate 'rules' for all compounds (requires iatom-ization)
#' @param iatoms Iatomcontainers with compounds
#' @param adduct_rules Adduct rule table (default is data(adduct_rules))
#' @return Table with all structures and if they pass the rules given for each adduct
#' @seealso
#' \code{\link[rcdk]{matches}},\code{\link[rcdk]{get.total.formal.charge}}
#' @rdname countAdductRuleMatches
#' @export
#' @examples
#' iatom = smiles.to.iatom(c('OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O'))
#' data(adduct_rules)
#' addScore <- countAdductRuleMatches(iatom, adduct_rules = adduct_rules)
#' @importFrom rcdk matches get.total.formal.charge
#' @importFrom data.table data.table
countAdductRuleMatches <- function(iatoms, adduct_rules) {
smiles <- iatom.to.smiles(iatoms)
res_cols <- lapply(1:nrow(adduct_rules), function(i) {
curr <- adduct_rules$SHORT[i]
query <- adduct_rules$SMARTS[i]
all_matches <- lapply(iatoms, function(iatom) {
if (curr != "Nch") {
all_matches <- list(mapping = list(a = c(1:10)))
try({
rcdk::matches(query = query, target = iatom, TRUE)
})
}
else {
rcdk::get.total.formal.charge(mol = iatom)
}
})
if (curr != "Nch") {
vals <- as.numeric(sapply(all_matches, function(x) length(x[[1]]$mapping)))
}
else {
vals <- as.numeric(unlist(all_matches))
}
add.col <- data.table::data.table(vals)
colnames(add.col) <- curr
add.col
})
res <- do.call("cbind", res_cols)
cbind(structure = smiles, res)
}
#' @title Check for combined adduct rules
#' @description Sometimes multiple rules apply - this function checks if they all apply as noted in the rule table.
#' @param adduct_rule_scores Scores from countAdductRuleMatches.
#' @param adduct_table Adduct table
#' @return Table with TRUE/FALSE for each structure and adduct
#' @seealso
#' \code{\link[data.table]{as.data.table}}
#' @rdname checkAdductRule
#' @export
#' @examples
#' iatom = smiles.to.iatom(c('OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O'))
#' data(adduct_rules)
#' data(adducts)
#' addScore <- countAdductRuleMatches(iatom, adduct_rules = adduct_rules)
#' checkAdductRule(addScore, adduct_table = adducts)
#' @importFrom data.table as.data.table data.table
checkAdductRule <- function(adduct_rule_scores, adduct_table) {
left_val <- NULL
adduct.qualify.cols <- lapply(1:nrow(adduct_table), function(i) {
row <- adduct_table[i, ]
name <- row$Name
ion_mode <- row$Ion_mode
rules_raw <- row$Rule
rules_split <- strsplit(rules_raw, "AND| AND ", )[[1]]
qualified_per_rule <- data.table::as.data.table(sapply(rules_split, function(rule) {
middle <- if (grepl("<", rule)) {
"below"
} else if (grepl(">", rule)) {
"above"
} else {
"equals"
}
leftright <- strsplit(rule, ">|<|=")[[1]]
left_val <- leftright[1]
right <- as.numeric(leftright[2])
left <- as.numeric(adduct_rule_scores[, left_val, with = FALSE][[1]])
qualifies <- switch(middle, below = left < right, equals = left == right, above = left > right)
data.table::as.data.table(qualifies)
}))
qualified.rule <- apply(qualified_per_rule, MARGIN = 1, FUN = all)
add.row <- data.table::data.table(qualified.rule)
colnames(add.row) <- row$Name
add.row
})
qualified.per.adduct <- do.call("cbind", adduct.qualify.cols)
data.table::data.table(structure = adduct_rule_scores$structure, qualified.per.adduct)
}
#' @title Generate adduct for given structure
#' @description Takes in formula, an adduct of interest, and returns adduct formulas and charges.
#' @param structure SMILES structure
#' @param formula Molecular formula
#' @param charge Initial charge
#' @param adduct_table Adduct table
#' @param query_adduct Adduct 'Name' of interest
#' @return Table with adducts of this compound
#' @seealso
#' \code{\link[enviPat]{check_chemform}},\code{\link[enviPat]{mergeform}},\code{\link[enviPat]{check_ded}},\code{\link[enviPat]{subform}},\code{\link[enviPat]{multiform}}
#' @rdname doAdduct
#' @export
#' @examples
#' data(adduct_rules)
#' data(adducts)
#' structure = 'OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O'
#' doAdduct(structure = structure, formula="C6H12O6", charge=0,
#' adduct_table=adducts, query_adduct="[M+H]1+")
#' @importFrom enviPat check_chemform mergeform check_ded subform multiform
#' @importFrom data.table data.table
doAdduct <- function(structure, formula, charge, adduct_table, query_adduct) {
Name <- final.charge <- NULL
row <- adduct_table[Name == query_adduct, ]
name <- row$Name
ion_mode <- row$Ion_mode
checked <- enviPat::check_chemform(isotopes, chemforms = formula)
phailed <- which(checked$warning)
if (all(checked$warning)) {
return(data.table::data.table())
}
unique_formulas <- unique(data.table::data.table(structure = structure, baseformula = checked$new_formula, charge = charge))
if (length(phailed) > 0) {
unique_formulas <- unique_formulas[-phailed, ]
}
adduct_before <- row$AddAt
deduct_before <- row$RemAt
adduct_before <- if (is.na(adduct_before)) {
FALSE
} else {
adduct_before
}
deduct_before <- if (is.na(deduct_before)) {
FALSE
} else {
deduct_before
}
if (!(adduct_before %in% c("", "FALSE", FALSE, NA))) {
unique_formulas$adducted <- enviPat::mergeform(formula1 = unique_formulas$baseformula, formula2 = adduct_before)
}
else {
unique_formulas$adducted <- unique_formulas$baseformula
}
if (!(deduct_before %in% c("", "FALSE", FALSE, NA))) {
can.deduct <- which(!as.logical(enviPat::check_ded(formulas = unique_formulas$adducted, deduct = deduct_before)))
if (length(can.deduct) == 0) {
return(data.table::data.table())
}
deductibles <- unique_formulas$adducted[can.deduct]
unique_formulas$adducted[can.deduct] <- enviPat::subform(deductibles, deduct_before)
unique_formulas <- unique_formulas[can.deduct]
}
unique_formulas <- unique_formulas[which(unique_formulas$adducted != "NANA"), ]
multiplier <- as.numeric(row$xM)
if (multiplier > 1) {
unique_formulas$adducted <- enviPat::multiform(unique_formulas$adducted, multiplier)
}
adduct_after <- row$AddEx
deduct_after <- row$RemEx
adduct_after <- if (is.na(adduct_after)) {
FALSE
} else {
adduct_after
}
deduct_after <- if (is.na(deduct_after)) {
FALSE
} else {
deduct_after
}
if (!(adduct_after %in% c("", "FALSE", FALSE, NA))) {
unique_formulas$adducted <- enviPat::mergeform(formula1 = unique_formulas$adducted, formula2 = adduct_after)
}
if (!(deduct_after %in% c("", "FALSE", FALSE, NA))) {
can.deduct <- which(!as.logical(enviPat::check_ded(formulas = unique_formulas$adducted, deduct = deduct_after)))
if (length(can.deduct) == 0) {
return(data.table::data.table())
}
unique_formulas$adducted[can.deduct] <- enviPat::subform(unique_formulas$adducted[can.deduct], deduct_after)
unique_formulas <- unique_formulas[can.deduct]
}
unique_formulas$final <- unique_formulas$adducted
if (nrow(unique_formulas) == 0) {
return(data.table::data.table())
}
unique_formulas$final.charge <- c(as.numeric(unique_formulas$charge)) + c(as.numeric(row$Charge))
unique_formulas <- unique_formulas[final.charge != 0]
if (nrow(unique_formulas) == 0) {
return(data.table::data.table())
}
unique_formulas
}
#' @title Generate isotopes for given formula
#' @description Takes in formula and returns isotope pattern m/z values.
#' @param formula Molecular formula
#' @param charge Final charge
#' @param count.isos Add columns for amounts of 2H, 13C, 15N atoms? Useful for heavy isotope experiments.
#' @return Table with isotopes of this molecular formula
#' @examples
#' doIsotopes(formula="C6H12O6", charge=0)
#' @seealso
#' \code{\link[enviPat]{isopattern}}
#' @rdname doIsotopes
#' @export
#' @importFrom enviPat isopattern
#' @importFrom data.table data.table
doIsotopes <- function(formula, charge, count.isos=F) {
# note these specifically: 2H, 13C, and 15N
isotables <- enviPat::isopattern(isotopes, formula, threshold = 0.1, plotit = FALSE, charge = charge, verbose = FALSE)
isolist <- lapply(isotables, function(isotable) {
if (isotable[[1]] == "error") {
return(data.table())
}
iso.dt <- data.table::data.table(isotable)
if(count.isos){
for(iso in c("2H","13C", "15N")){
if(iso %in% colnames(iso.dt)){
iso.dt[[paste0("n",iso)]] <- iso.dt[[iso]]
}else{
iso.dt[[paste0("n",iso)]] <- c(0)
}
}
}
result <- iso.dt[, c(c("m/z","abundance"), if(count.isos) c("n2H","n13C", "n15N") else c()), with=F]
names(result) <- c(c("fullmz", "isoprevalence"), if(count.isos) c("n2H","n13C", "n15N") else c())
result
})
isolist.nonas <- isolist[!is.na(isolist)]
isotable <- data.table::rbindlist(isolist.nonas, fill = T)
keep.isos <- names(isolist.nonas)
charges <- charge[!is.na(isolist)]
repeat.times <- c(unlist(lapply(isolist.nonas, FUN = function(list) nrow(list))))
isotable$final <- rep(keep.isos, repeat.times)
isotable$final.charge <- rep(charges, repeat.times)
isotable
}
#' @title Build external database using a given base database
#' @description Wrapper function that takes a base database, an existing (or not) external database, and fills the extended database with adduct and isotope variants of the compounds in the base database.
#' @param outfolder Which folder are your databases in?
#' @param ext.dbname Extended database name (without .db suffix), Default: 'extended'
#' @param base.dbname Base database name (without .db suffix)
#' @param cl parallel::makeCluster object for multithreading, Default: 0
#' @param blocksize How many compounds to process simultanaously? Higher means more memory spikes but faster building, Default: 600
#' @param mzrange Range of m/zs to include in database, Default: c(60, 600)
#' @param adduct_table Adduct table, Default: adducts
#' @param adduct_rules Adduct rule table, Default: adduct_rules
#' @param silent Silence warnings?, Default: silent
#' @param use.rules Use adduct rules?, Default: TRUE
#' @param all.isos Include and calculate all isotopes? (if FALSE, only takes the 100/main isotope).
#' @param count.isos Add columns for amounts of 2H, 13C, 15N atoms? Useful for heavy isotope experiments.
#' @seealso
#' \code{\link[RSQLite]{SQLite}}
#' \code{\link[gsubfn]{fn}}
#' \code{\link[data.table]{as.data.table}},\code{\link[data.table]{rbindlist}},\code{\link[data.table]{fwrite}},\code{\link[data.table]{fread}}
#' \code{\link[DBI]{dbWriteTable}}
#' \code{\link[pbapply]{pbapply}}
#' \code{\link[enviPat]{check_chemform}}
#' @rdname buildExtDB
#' @export
#' @examples
#' \dontrun{myFolder = tempdir()}
#' \dontrun{buildBaseDB(outfolder = myFolder, "lmdb", test = TRUE)}
#' \dontrun{file.remove(file.path(myFolder, "extended.db"))}
#' \dontrun{data(adducts)}
#' \dontrun{data(adduct_rules)}
#' \dontrun{buildExtDB(outfolder = myFolder, base.dbname = "lmdb",
#' silent=FALSE, adduct_table = adducts, adduct_rules = adduct_rules)}
#' @importFrom RSQLite dbConnect SQLite dbExecute dbExistsTable dbGetQuery dbDisconnect dbWriteTable dbReadTable
#' @importFrom gsubfn fn
#' @importFrom data.table as.data.table data.table rbindlist fwrite fread
#' @importFrom DBI dbWriteTable
#' @importFrom pbapply pblapply pbsapply
#' @importFrom enviPat check_chemform
buildExtDB <- function(outfolder, ext.dbname = "extended", base.dbname, cl = 0,
blocksize = 600, mzrange = c(60, 600), adduct_table = adducts,
adduct_rules = adduct_rules, silent = silent, use.rules = TRUE,
count.isos = F, all.isos = T) {
Name <- charge <- ..add <- ..keepcols <- NULL
outfolder <- normalizePath(outfolder)
print(paste("Will calculate adducts + isotopes for the", base.dbname, "database."))
full.db <- file.path(outfolder, paste0(ext.dbname, ".db"))
first.db <- !file.exists(full.db)
full.conn <- RSQLite::dbConnect(RSQLite::SQLite(), full.db)
if(!first.db){
cols = RSQLite::dbListFields(full.conn,"extended")
if("n2H" %in% cols & count.isos == F){
print("Cannot only build a singular DB without heavy atom counts. Reverting to default settings...")
count.isos = T
}
if(!("n2H" %in% cols) & count.isos == T){
print("Cannot only build a singular DB with heavy atom counts. Reverting to default settings...")
count.isos = F
}
}
tempdir <- file.path(outfolder, paste0(ext.dbname, "_inprogress"))
if (dir.exists(tempdir)) {
tmpfiles.ext <- list.files(tempdir, full.names = TRUE, pattern = "_ext_")
tmpfiles.struct <- list.files(tempdir, full.names = TRUE, pattern = "_str_")
if (length(tmpfiles.ext) > 0) {
prevDB <- gsub("_.*$|\\.csv", "", basename(tmpfiles.ext[1]))
print(paste("! ! ! failed to finish", prevDB, "database ! ! !"))
print("recovery mode, loading done structures into database... please stand by o wo ")
pbapply::pbsapply(1:length(tmpfiles.ext), function(i) {
try({
extended_csv <- data.table::fread(tmpfiles.ext[i])
RSQLite::dbWriteTable(full.conn, "extended", extended_csv, append = TRUE)
if (length(tmpfiles.struct > 0)) {
structures_csv <- data.table::fread(tmpfiles.struct[i])
RSQLite::dbWriteTable(full.conn, "structures", structures_csv, append = TRUE)
}
})
})
}
unlink(tempdir, recursive = TRUE)
}
dir.create(tempdir)
RSQLite::dbExecute(full.conn, gsubfn::fn$paste("PRAGMA foreign_keys = ON"))
RSQLite::dbExecute(full.conn, "CREATE TABLE IF NOT EXISTS structures(struct_id INT PRIMARY KEY,
smiles TEXT,
UNIQUE(struct_id, smiles))")
if (RSQLite::dbExistsTable(full.conn, "extended")) {
done_adducts <- RSQLite::dbGetQuery(full.conn, gsubfn::fn$paste("SELECT DISTINCT Name FROM adducts
WHERE dbname == '$base.dbname'"))[, 1]
new_adducts <- setdiff(adduct_table$Name, done_adducts)
}
else {
new_adducts <- adducts$Name
}
#"n2H", "n13C", "n15N"
extras = if(count.isos) ",n2H int,n13C int,n15N int" else ""
RSQLite::dbExecute(full.conn, gsubfn::fn$paste(strwrap("CREATE TABLE IF NOT EXISTS extended(
struct_id INT,
fullformula text,
finalcharge text,
fullmz decimal(30,13),
adduct text,
isoprevalence float
$extras)", width = 10000, simplify = TRUE)))
RSQLite::dbExecute(full.conn, gsubfn::fn$paste("PRAGMA auto_vacuum = 1;"))
base.db <- normalizePath(file.path(outfolder, paste0(base.dbname, ".db")))
RSQLite::dbExecute(full.conn, gsubfn::fn$paste("ATTACH '$base.db' AS tmp"))
if (first.db) {
RSQLite::dbExecute(full.conn, "CREATE INDEX st_idx1 ON structures(smiles)")
RSQLite::dbExecute(full.conn, "CREATE INDEX e_idx1 on extended(struct_id)")
RSQLite::dbExecute(full.conn, "CREATE INDEX e_idx2 on extended(fullmz)")
RSQLite::dbExecute(full.conn, "PRAGMA journal_mode=WAL;")
}
if (first.db) {
to.do <- RSQLite::dbGetQuery(full.conn, "SELECT DISTINCT baseformula, structure, charge
FROM tmp.base")
to.do$struct_id <- c(NA)
adduct_only <- FALSE
}
else {
to.do <- RSQLite::dbGetQuery(full.conn, "SELECT DISTINCT baseformula, structure, charge
FROM tmp.base LEFT JOIN structures str
ON base.structure = str.smiles
WHERE str.smiles IS NULL")
if (length(new_adducts) > 0) {
adduct_only <- if (nrow(to.do) == 0) {
TRUE
} else {
FALSE
}
if (adduct_only) {
print(paste0("New adducts: ", paste0(new_adducts, collapse = ",")))
to.do <- RSQLite::dbGetQuery(full.conn, "SELECT DISTINCT baseformula,
structure, charge
FROM tmp.base")
to.do$struct_id <- c(NA)
adduct_table <- data.table::as.data.table(adduct_table)[Name %in% new_adducts, ]
}
}
else {
adduct_only <- FALSE
}
}
if (nrow(to.do) == 0) {
print("all already done")
RSQLite::dbDisconnect(full.conn)
return(NULL)
}
done.structures <- if (first.db) {
0
} else {
RSQLite::dbGetQuery(full.conn, "SELECT MAX(struct_id) FROM structures")[, 1]
}
to.do <- to.do[!grepl(pattern = " ", to.do$baseformula), ]
start.id <- done.structures + 1
mapper <- data.table::data.table(struct_id = seq(start.id, start.id + nrow(to.do) - 1, 1), smiles = to.do$structure, baseformula = to.do$baseformula, charge = as.numeric(to.do$charge))
if (adduct_only) {
print("Getting structure IDs...")
mapper_now <- unique(mapper[, -"struct_id"])
DBI::dbWriteTable(full.conn, "mapper", mapper_now, overwrite = TRUE)
mapper_filled <- data.table::as.data.table(RSQLite::dbGetQuery(full.conn, "SELECT * FROM structures s JOIN mapper m ON s.smiles = m.smiles"))
mapper <- mapper_filled[, c("struct_id", "smiles", "baseformula", "charge")]
}
mapper[is.na(charge)]$charge <- c(0)
print(paste("Parsing", nrow(mapper), "new compounds..."))
blocks <- split(mapper, ceiling(seq_along(1:nrow(mapper)) / blocksize))
tmpfiles.ext <- sapply(1:length(blocks), function(i) file.path(tempdir, paste0(base.dbname, "_ext_", i, ".csv")))
tmpfiles.struct <- sapply(1:length(blocks), function(i) file.path(tempdir, paste0(base.dbname, "_str_", i, ".csv")))
RSQLite::dbDisconnect(full.conn)
per.adduct.tables <- pbapply::pblapply(1:length(blocks), cl = cl, function(i, mzrange = mzrange, silent = silent, blocks = blocks, adduct_table = adduct_table, adduct_rules = adduct_rules, tmpfiles.ext = tmpfiles.ext, tmpfiles.struct = tmpfiles.struct, mapper = mapper, use.rules = use.rules) {
block <- blocks[[i]]
deut <- grep(block$baseformula, pattern = "D")
if (length(deut) > 0) {
block$baseformula[deut] <- gsub(block$baseformula[deut], pattern = "D", replacement = "[2]H")
}
if (use.rules) {
iatoms <- smiles.to.iatom(block$smiles, silent = silent)
bad.structures <- which(sapply(iatoms, is.null))
good.structures <- which(!sapply(iatoms, is.null))
}
else {
iatoms <- c()
bad.structures <- 1:length(iatoms)
good.structures <- c()
}
structure.adducts.possible <- data.table::data.table()
if (length(good.structures) > 0 | use.rules) {
parsable.iats <- iatoms[good.structures]
structure.reactive.groups <- countAdductRuleMatches(parsable.iats, adduct_rules)
structure.adducts.possible <- checkAdductRule(structure.reactive.groups, adduct_table)
}
per.adduct.tables <- lapply(adduct_table$Name, function(add) {
has.structure.can.adduct <- data.table::data.table()
if (use.rules) {
if (nrow(structure.adducts.possible) > 0) {
addCol <- unlist(structure.adducts.possible[, add, with = FALSE])
has.structure.can.adduct <- block[good.structures[addCol]]
}
no.structure <- block[bad.structures]
block.calc.adduct <- rbind(has.structure.can.adduct, no.structure)
}
else {
block.calc.adduct <- block
}
if (nrow(block.calc.adduct) == 0) {
return(data.table::data.table())
}
adducted <- doAdduct(structure = block.calc.adduct$smiles, formula = block.calc.adduct$baseformula, charge = block.calc.adduct$charge, adduct_table = adduct_table, query_adduct = add)
if (nrow(adducted) == 0) {
return(data.table::data.table())
}
checked <- enviPat::check_chemform(isotopes, adducted$final)
checked$mz <- checked$monoisotopic_mass / abs(adducted$final.charge)
keepers <- which(checked$mz %between% mzrange)
if (length(keepers) == 0) {
return(data.table::data.table())
}
else {
if(all.isos){
isotable <- doIsotopes(formula = adducted[keepers, ]$final,
charge = adducted[keepers, ]$final.charge,
count.isos = count.isos)
}else {
# names(result) <- c(c("fullmz", "isoprevalence"), if(count.isos) c("n2H","n13C", "n15N") else c())
isotable = data.table::data.table(fullmz = checked[keepers, ]$mz,
isoprevalence = c(100),
final = adducted[keepers, ]$final,
final.charge = adducted[keepers, ]$final.charge)
if(count.isos) isotable$n2H <- isotable$n13C <- isotable$n15N <- c(0)
}
formula_plus_iso <- merge(adducted,
isotable,
by = c("final", "final.charge"),
allow.cartesian = TRUE)
adducted.plus.isotopes <- merge(adducted,
formula_plus_iso,
by = c("baseformula", "charge", "adducted",
"final.charge", "final", "structure"),
allow.cartesian = TRUE)
meta.table <- data.table::data.table(fullmz = adducted.plus.isotopes$fullmz,
fullformula = adducted.plus.isotopes$final,
finalcharge = adducted.plus.isotopes$final.charge,
adduct = c(add),
isoprevalence = adducted.plus.isotopes$isoprevalence,
structure = adducted.plus.isotopes$structure)
if(count.isos){
meta.table$n13C <- adducted.plus.isotopes$n13C
meta.table$n2H <- adducted.plus.isotopes$n2H
meta.table$n15N <- adducted.plus.isotopes$n15N
}
ids <- mapper$struct_id[match(meta.table$structure,
mapper$smiles)]
meta.table$struct_id <- ids
res = unique(meta.table[, -"structure"])
return(res)
}
})
to.write <- data.table::rbindlist(per.adduct.tables, fill = T)
to.write <<- to.write
if (nrow(to.write) > 0) {
structs <- unique(blocks[[i]][, c("struct_id", "smiles")])
keepcols = c("struct_id", "fullformula", "finalcharge",
"fullmz", "adduct", "isoprevalence",
if(count.isos) c("n2H","n13C","n15N") else c())
data.table::fwrite(to.write[, ..keepcols],
file = tmpfiles.ext[i], append = FALSE)
if (!adduct_only) {
data.table::fwrite(structs, file = tmpfiles.struct[i], append = FALSE)
}
}
}, mzrange = mzrange, silent = silent, blocks = blocks, adduct_table = adduct_table, adduct_rules = adduct_rules, tmpfiles.ext = tmpfiles.ext, tmpfiles.struct = tmpfiles.struct, mapper = mapper, use.rules = use.rules)
print("loading into database... please stand by - w- ")
pbapply::pbsapply(1:length(blocks), function(i) {
full.conn <- RSQLite::dbConnect(RSQLite::SQLite(), full.db)
try({
extended_csv <- data.table::fread(tmpfiles.ext[i])
structures_csv <- data.table::fread(tmpfiles.struct[i])
RSQLite::dbWriteTable(full.conn, "extended", extended_csv, append = TRUE)
if (!adduct_only) {
RSQLite::dbWriteTable(full.conn, "structures", structures_csv, append = TRUE)
}
})
RSQLite::dbDisconnect(full.conn)
})
full.conn <- RSQLite::dbConnect(RSQLite::SQLite(), full.db)
adduct_table$dbname <- base.dbname
addcols = c("Name",
"Ion_mode",
"Charge",
"xM",
"AddAt",
"RemAt",
"AddEx",
"RemEx",
"Nelec",
"Rule",
"Info",
"dbname")
if (!first.db) {
existing_adducts <- data.table::as.data.table(RSQLite::dbReadTable(full.conn, "adducts"))
adduct_tbl_named <- unique(rbind(adduct_table[,..addcols], existing_adducts[,..addcols]))
}
else {
adduct_tbl_named <- adduct_table[,..addcols]
}
RSQLite::dbWriteTable(full.conn, "adducts", as.data.frame(adduct_tbl_named), overwrite = TRUE)
RSQLite::dbDisconnect(full.conn)
unlink(c(tmpfiles.ext, tmpfiles.struct))
}
Add the following code to your website.
For more information on customizing the embed code, read Embedding Snippets.